C28H29N3OS — CID 5181672
[[benzo[e][1]benzofuran-2-yl-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]methylidene]amino]thiourea (PubChem CID 5181672) has the molecular formula C28H29N3OS and a molecular weight of 455.63 g/mol. Its IUPAC name is [[benzo[e][1]benzofuran-2-yl-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]methylidene]amino]thiourea.
| Compound Name | [[benzo[e][1]benzofuran-2-yl-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]methylidene]amino]thiourea |
|---|---|
| PubChem CID | 5181672 |
| Molecular Formula | C28H29N3OS |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | [[benzo[e][1]benzofuran-2-yl-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]methylidene]amino]thiourea |
| SMILES | Cc1cc(C)c(C2(C)CC(C(=NNC(N)=S)c3cc4c(ccc5ccccc54)o3)C2)c(C)c1 |
| InChI | InChI=1S/C28H29N3OS/c1-16-11-17(2)25(18(3)12-16)28(4)14-20(15-28)26(30-31-27(29)33)24-13-22-21-8-6-5-7-19(21)9-10-23(22)32-24/h5-13,20H,14-15H2,1-4H3,(H3,29,31,33) |
| InChIKey | QUKOAPNSFJVDQA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|