C16H14Cl5N3O — CID 5182415
4-(butylamino)-2,5,6-trichloro-N-(2,5-dichlorophenyl)pyridine-3-carboxamide (PubChem CID 5182415) has the molecular formula C16H14Cl5N3O and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-(butylamino)-2,5,6-trichloro-N-(2,5-dichlorophenyl)pyridine-3-carboxamide.
| Compound Name | 4-(butylamino)-2,5,6-trichloro-N-(2,5-dichlorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 5182415 |
| Molecular Formula | C16H14Cl5N3O |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | 4-(butylamino)-2,5,6-trichloro-N-(2,5-dichlorophenyl)pyridine-3-carboxamide |
| SMILES | CCCCNc1c(Cl)c(Cl)nc(Cl)c1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14Cl5N3O/c1-2-3-6-22-13-11(14(20)24-15(21)12(13)19)16(25)23-10-7-8(17)4-5-9(10)18/h4-5,7H,2-3,6H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | SEARITQUTYEEES-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|