C19H21N3O4 — CID 51829656
3-[(4S)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(furan-2-ylmethyl)propanamide (PubChem CID 51829656) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-[(4S)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 3-[(4S)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 51829656 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-[(4S)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(furan-2-ylmethyl)propanamide |
| SMILES | C[C@H](c1ccccc1)N1C(=O)N[C@@H](CCC(=O)NCc2ccco2)C1=O |
| InChI | InChI=1S/C19H21N3O4/c1-13(14-6-3-2-4-7-14)22-18(24)16(21-19(22)25)9-10-17(23)20-12-15-8-5-11-26-15/h2-8,11,13,16H,9-10,12H2,1H3,(H,20,23)(H,21,25)/t13-,16+/m1/s1 |
| InChIKey | ULBULRUDAHSUDY-CJNGLKHVSA-N |
| XLogP | 2.36 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|