C26H25N3O4 — CID 51836598
3-[(4R)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(4-phenoxyphenyl)propanamide (PubChem CID 51836598) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-[(4R)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(4-phenoxyphenyl)propanamide.
| Compound Name | 3-[(4R)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(4-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 51836598 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-[(4R)-2,5-dioxo-1-[(1R)-1-phenylethyl]imidazolidin-4-yl]-N-(4-phenoxyphenyl)propanamide |
| SMILES | C[C@H](c1ccccc1)N1C(=O)N[C@H](CCC(=O)Nc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C26H25N3O4/c1-18(19-8-4-2-5-9-19)29-25(31)23(28-26(29)32)16-17-24(30)27-20-12-14-22(15-13-20)33-21-10-6-3-7-11-21/h2-15,18,23H,16-17H2,1H3,(H,27,30)(H,28,32)/t18-,23-/m1/s1 |
| InChIKey | MTZKOBDCISCBKC-WZONZLPQSA-N |
| XLogP | 4.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|