C25H30N4O6 — CID 51829693
(3R)-3-[2-oxo-2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 51829693) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is (3R)-3-[2-oxo-2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3R)-3-[2-oxo-2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 51829693 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (3R)-3-[2-oxo-2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | COc1ccc(CN2CCN(C(=O)C[C@H]3NC(=O)c4ccccc4NC3=O)CC2)c(OC)c1OC |
| InChI | InChI=1S/C25H30N4O6/c1-33-20-9-8-16(22(34-2)23(20)35-3)15-28-10-12-29(13-11-28)21(30)14-19-25(32)26-18-7-5-4-6-17(18)24(31)27-19/h4-9,19H,10-15H2,1-3H3,(H,26,32)(H,27,31)/t19-/m1/s1 |
| InChIKey | FBUVVXJKIYYXDL-LJQANCHMSA-N |
| XLogP | 1.50 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |