C28H28N2O3 — CID 51851467
4-methoxy-3-[(3-methylphenoxy)methyl]-N-[(1S)-1-(3-pyrrol-1-ylphenyl)ethyl]benzamide (PubChem CID 51851467) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-methoxy-3-[(3-methylphenoxy)methyl]-N-[(1S)-1-(3-pyrrol-1-ylphenyl)ethyl]benzamide.
| Compound Name | 4-methoxy-3-[(3-methylphenoxy)methyl]-N-[(1S)-1-(3-pyrrol-1-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 51851467 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-methoxy-3-[(3-methylphenoxy)methyl]-N-[(1S)-1-(3-pyrrol-1-ylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](C)c2cccc(-n3cccc3)c2)cc1COc1cccc(C)c1 |
| InChI | InChI=1S/C28H28N2O3/c1-20-8-6-11-26(16-20)33-19-24-17-23(12-13-27(24)32-3)28(31)29-21(2)22-9-7-10-25(18-22)30-14-4-5-15-30/h4-18,21H,19H2,1-3H3,(H,29,31)/t21-/m0/s1 |
| InChIKey | QMFJAXNDUBBJIG-NRFANRHFSA-N |
| XLogP | 5.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |