C20H20N8O3 — CID 51855339
N-[(2S)-1-(1,3-dimethylpyrazol-4-yl)propan-2-yl]-5-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 51855339) has the molecular formula C20H20N8O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-[(2S)-1-(1,3-dimethylpyrazol-4-yl)propan-2-yl]-5-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | N-[(2S)-1-(1,3-dimethylpyrazol-4-yl)propan-2-yl]-5-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 51855339 |
| Molecular Formula | C20H20N8O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[(2S)-1-(1,3-dimethylpyrazol-4-yl)propan-2-yl]-5-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | Cc1nn(C)cc1C[C@H](C)NC(=O)c1cc(-c2cccc([N+](=O)[O-])c2)nc2ncnn12 |
| InChI | InChI=1S/C20H20N8O3/c1-12(7-15-10-26(3)25-13(15)2)23-19(29)18-9-17(24-20-21-11-22-27(18)20)14-5-4-6-16(8-14)28(30)31/h4-6,8-12H,7H2,1-3H3,(H,23,29)/t12-/m0/s1 |
| InChIKey | UAEGYKALRQZULM-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|