C27H32N4O2 — CID 5186742
N-cyclohexyl-N'-[3-methyl-1-(4-methylphenyl)-4-phenylpyrazol-5-yl]butanediamide (PubChem CID 5186742) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-cyclohexyl-N'-[3-methyl-1-(4-methylphenyl)-4-phenylpyrazol-5-yl]butanediamide.
| Compound Name | N-cyclohexyl-N'-[3-methyl-1-(4-methylphenyl)-4-phenylpyrazol-5-yl]butanediamide |
|---|---|
| PubChem CID | 5186742 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-cyclohexyl-N'-[3-methyl-1-(4-methylphenyl)-4-phenylpyrazol-5-yl]butanediamide |
| SMILES | Cc1ccc(-n2nc(C)c(-c3ccccc3)c2NC(=O)CCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-19-13-15-23(16-14-19)31-27(26(20(2)30-31)21-9-5-3-6-10-21)29-25(33)18-17-24(32)28-22-11-7-4-8-12-22/h3,5-6,9-10,13-16,22H,4,7-8,11-12,17-18H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | OVRFJLJONZJFHH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |