C27H32ClN3O2 — CID 5186912
N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-cyclopentyl-N-ethylpropanamide (PubChem CID 5186912) has the molecular formula C27H32ClN3O2 and a molecular weight of 466.03 g/mol. Its IUPAC name is N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-cyclopentyl-N-ethylpropanamide.
| Compound Name | N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-cyclopentyl-N-ethylpropanamide |
|---|---|
| PubChem CID | 5186912 |
| Molecular Formula | C27H32ClN3O2 |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-cyclopentyl-N-ethylpropanamide |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1cccc(Cl)c1)N(CC)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C27H32ClN3O2/c1-3-24(30(4-2)25(32)17-16-19-10-5-6-11-19)26-29-23-15-8-7-14-22(23)27(33)31(26)21-13-9-12-20(28)18-21/h7-9,12-15,18-19,24H,3-6,10-11,16-17H2,1-2H3 |
| InChIKey | VZVJNUBQWXYFGQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |