C16H18FN5O2 — CID 51871988
(4R,5R)-3-(4-fluorophenyl)-4-methyl-N-[(2R)-2-(1,2,4-triazol-1-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 51871988) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is (4R,5R)-3-(4-fluorophenyl)-4-methyl-N-[(2R)-2-(1,2,4-triazol-1-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (4R,5R)-3-(4-fluorophenyl)-4-methyl-N-[(2R)-2-(1,2,4-triazol-1-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 51871988 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (4R,5R)-3-(4-fluorophenyl)-4-methyl-N-[(2R)-2-(1,2,4-triazol-1-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | C[C@@H]1C(c2ccc(F)cc2)=NO[C@H]1C(=O)NC[C@@H](C)n1cncn1 |
| InChI | InChI=1S/C16H18FN5O2/c1-10(22-9-18-8-20-22)7-19-16(23)15-11(2)14(21-24-15)12-3-5-13(17)6-4-12/h3-6,8-11,15H,7H2,1-2H3,(H,19,23)/t10-,11-,15-/m1/s1 |
| InChIKey | YRWTYVLKJWIIKV-UEKVPHQBSA-N |
| XLogP | 1.53 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |