C14H13FN4O2S2 — CID 51873737
(5R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 51873737) has the molecular formula C14H13FN4O2S2 and a molecular weight of 352.42 g/mol. Its IUPAC name is (5R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (5R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 51873737 |
| Molecular Formula | C14H13FN4O2S2 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (5R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CCSc1nnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 |
| InChI | InChI=1S/C14H13FN4O2S2/c1-2-22-14-18-17-13(23-14)16-12(20)11-7-10(19-21-11)8-4-3-5-9(15)6-8/h3-6,11H,2,7H2,1H3,(H,16,17,20)/t11-/m1/s1 |
| InChIKey | CVJRMOIXHNGKRB-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|