C18H36N2O — CID 5187619
N-(2,4-dimethylpentan-3-ylideneamino)undecanamide (PubChem CID 5187619) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is N-(2,4-dimethylpentan-3-ylideneamino)undecanamide.
| Compound Name | N-(2,4-dimethylpentan-3-ylideneamino)undecanamide |
|---|---|
| PubChem CID | 5187619 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | N-(2,4-dimethylpentan-3-ylideneamino)undecanamide |
| SMILES | CCCCCCCCCCC(=O)NN=C(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36N2O/c1-6-7-8-9-10-11-12-13-14-17(21)19-20-18(15(2)3)16(4)5/h15-16H,6-14H2,1-5H3,(H,19,21) |
| InChIKey | AGBHBTQUUVTBRW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|