C15H24FNO3 — CID 51895854
(2R)-1-[2-(4-fluorophenoxy)ethoxy]-3-(2-methylpropylamino)propan-2-ol (PubChem CID 51895854) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is (2R)-1-[2-(4-fluorophenoxy)ethoxy]-3-(2-methylpropylamino)propan-2-ol.
| Compound Name | (2R)-1-[2-(4-fluorophenoxy)ethoxy]-3-(2-methylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 51895854 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2R)-1-[2-(4-fluorophenoxy)ethoxy]-3-(2-methylpropylamino)propan-2-ol |
| SMILES | CC(C)CNC[C@@H](O)COCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C15H24FNO3/c1-12(2)9-17-10-14(18)11-19-7-8-20-15-5-3-13(16)4-6-15/h3-6,12,14,17-18H,7-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | OLKQYJBCTFYMIM-CQSZACIVSA-N |
| XLogP | 1.83 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|