C14H22BrClNO3- — CID 53347434
1-[2-(4-bromophenoxy)ethoxy]-3-(propan-2-ylamino)propan-2-ol chloride (PubChem CID 53347434) has the molecular formula C14H22BrClNO3- and a molecular weight of 367.69 g/mol. Its IUPAC name is 1-[2-(4-bromophenoxy)ethoxy]-3-(propan-2-ylamino)propan-2-ol chloride.
| Compound Name | 1-[2-(4-bromophenoxy)ethoxy]-3-(propan-2-ylamino)propan-2-ol chloride |
|---|---|
| PubChem CID | 53347434 |
| Molecular Formula | C14H22BrClNO3- |
| Molecular Weight | 367.69 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 1-[2-(4-bromophenoxy)ethoxy]-3-(propan-2-ylamino)propan-2-ol chloride |
| SMILES | CC(C)NCC(O)COCCOc1ccc(Br)cc1.[Cl-] |
| InChI | InChI=1S/C14H22BrNO3.ClH/c1-11(2)16-9-13(17)10-18-7-8-19-14-5-3-12(15)4-6-14;/h3-6,11,13,16-17H,7-10H2,1-2H3;1H/p-1 |
| InChIKey | WKTZJDVXZGEHMU-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.69 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|