C30H31N3O5 — CID 5189952
4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 5189952) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is 4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5189952 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCN2CCOCC2)C(c2ccc(OCc3ccccc3)cc2)C1=C(O)c1ccncc1 |
| InChI | InChI=1S/C30H31N3O5/c34-28(24-11-13-31-14-12-24)26-27(23-7-9-25(10-8-23)38-21-22-5-2-1-3-6-22)33(30(36)29(26)35)16-4-15-32-17-19-37-20-18-32/h1-3,5-14,27,34H,4,15-21H2 |
| InChIKey | FCPWMOAPNMAZQR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|