C22H21NO3 — CID 51928585
N-[(S)-cyclopropyl-(4-methylphenyl)methyl]-6-methyl-4-oxochromene-2-carboxamide (PubChem CID 51928585) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[(S)-cyclopropyl-(4-methylphenyl)methyl]-6-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-[(S)-cyclopropyl-(4-methylphenyl)methyl]-6-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 51928585 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[(S)-cyclopropyl-(4-methylphenyl)methyl]-6-methyl-4-oxochromene-2-carboxamide |
| SMILES | Cc1ccc([C@@H](NC(=O)c2cc(=O)c3cc(C)ccc3o2)C2CC2)cc1 |
| InChI | InChI=1S/C22H21NO3/c1-13-3-6-15(7-4-13)21(16-8-9-16)23-22(25)20-12-18(24)17-11-14(2)5-10-19(17)26-20/h3-7,10-12,16,21H,8-9H2,1-2H3,(H,23,25)/t21-/m1/s1 |
| InChIKey | LYYWAIRWWBAGOE-OAQYLSRUSA-N |
| XLogP | 4.29 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |