C21H21N3O4 — CID 51930104
[(3S)-2-(4-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 51930104) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is [(3S)-2-(4-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3S)-2-(4-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 51930104 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(3S)-2-(4-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@@H]1Cc2ccccc2CN1C(=O)c1ccc([N+](=O)[O-])cc1)N1CCCC1 |
| InChI | InChI=1S/C21H21N3O4/c25-20(15-7-9-18(10-8-15)24(27)28)23-14-17-6-2-1-5-16(17)13-19(23)21(26)22-11-3-4-12-22/h1-2,5-10,19H,3-4,11-14H2/t19-/m0/s1 |
| InChIKey | FFEDSVGOBMJBOO-IBGZPJMESA-N |
| XLogP | 2.78 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|