C19H20F2N2O2S — CID 51930414
(2S)-N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbothioamide (PubChem CID 51930414) has the molecular formula C19H20F2N2O2S and a molecular weight of 378.44 g/mol. Its IUPAC name is (2S)-N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbothioamide.
| Compound Name | (2S)-N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 51930414 |
| Molecular Formula | C19H20F2N2O2S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2S)-N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbothioamide |
| SMILES | COc1ccc([C@@H]2CCCN2C(=S)Nc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C19H20F2N2O2S/c1-24-17-8-5-12(10-18(17)25-2)16-4-3-9-23(16)19(26)22-15-7-6-13(20)11-14(15)21/h5-8,10-11,16H,3-4,9H2,1-2H3,(H,22,26)/t16-/m0/s1 |
| InChIKey | ZMGIZVYKIRUEBF-INIZCTEOSA-N |
| XLogP | 4.52 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|