C16H18N2O4S — CID 51930757
methyl (3S)-3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-thiophen-2-ylpropanoate (PubChem CID 51930757) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is methyl (3S)-3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (3S)-3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 51930757 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | methyl (3S)-3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C[C@H](NC(=O)c1cc(C(C)=O)cn1C)c1cccs1 |
| InChI | InChI=1S/C16H18N2O4S/c1-10(19)11-7-13(18(2)9-11)16(21)17-12(8-15(20)22-3)14-5-4-6-23-14/h4-7,9,12H,8H2,1-3H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | HQYIRUOYRUSBGW-LBPRGKRZSA-N |
| XLogP | 2.32 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |