C20H23ClN4O2 — CID 51935544
(3S)-1-(3-chlorophenyl)-N-(2-cyclohexylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 51935544) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is (3S)-1-(3-chlorophenyl)-N-(2-cyclohexylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(3-chlorophenyl)-N-(2-cyclohexylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51935544 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (3S)-1-(3-chlorophenyl)-N-(2-cyclohexylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccnn1C1CCCCC1)[C@H]1CC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H23ClN4O2/c21-15-5-4-8-17(12-15)24-13-14(11-19(24)26)20(27)23-18-9-10-22-25(18)16-6-2-1-3-7-16/h4-5,8-10,12,14,16H,1-3,6-7,11,13H2,(H,23,27)/t14-/m0/s1 |
| InChIKey | XQBPHOLEDRPGKG-AWEZNQCLSA-N |
| XLogP | 4.03 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |