C20H23BrN4O2 — CID 55583267
1-(4-bromo-3-methylphenyl)-N-(2-cyclopentylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55583267) has the molecular formula C20H23BrN4O2 and a molecular weight of 431.33 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-N-(2-cyclopentylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-bromo-3-methylphenyl)-N-(2-cyclopentylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55583267 |
| Molecular Formula | C20H23BrN4O2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-N-(2-cyclopentylpyrazol-3-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cc(N2CC(C(=O)Nc3ccnn3C3CCCC3)CC2=O)ccc1Br |
| InChI | InChI=1S/C20H23BrN4O2/c1-13-10-16(6-7-17(13)21)24-12-14(11-19(24)26)20(27)23-18-8-9-22-25(18)15-4-2-3-5-15/h6-10,14-15H,2-5,11-12H2,1H3,(H,23,27) |
| InChIKey | MFJOOCNSDHPOOC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |