C20H20BrN3O4 — CID 51935716
(3S)-1-(2-bromophenyl)-N-methyl-N-[(1R)-1-(3-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 51935716) has the molecular formula C20H20BrN3O4 and a molecular weight of 446.30 g/mol. Its IUPAC name is (3S)-1-(2-bromophenyl)-N-methyl-N-[(1R)-1-(3-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(2-bromophenyl)-N-methyl-N-[(1R)-1-(3-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51935716 |
| Molecular Formula | C20H20BrN3O4 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | (3S)-1-(2-bromophenyl)-N-methyl-N-[(1R)-1-(3-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | C[C@H](c1cccc([N+](=O)[O-])c1)N(C)C(=O)[C@H]1CC(=O)N(c2ccccc2Br)C1 |
| InChI | InChI=1S/C20H20BrN3O4/c1-13(14-6-5-7-16(10-14)24(27)28)22(2)20(26)15-11-19(25)23(12-15)18-9-4-3-8-17(18)21/h3-10,13,15H,11-12H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | TYYIRNICFRSZCM-HIFRSBDPSA-N |
| XLogP | 3.93 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|