C20H29N3O4 — CID 51222532
1-(2,2-dimethylpropanoyl)-N-methyl-N-[1-(3-nitrophenyl)ethyl]piperidine-4-carboxamide (PubChem CID 51222532) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-methyl-N-[1-(3-nitrophenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-methyl-N-[1-(3-nitrophenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51222532 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-methyl-N-[1-(3-nitrophenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CC(c1cccc([N+](=O)[O-])c1)N(C)C(=O)C1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-14(16-7-6-8-17(13-16)23(26)27)21(5)18(24)15-9-11-22(12-10-15)19(25)20(2,3)4/h6-8,13-15H,9-12H2,1-5H3 |
| InChIKey | ICRQIPDBHVWYQT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|