C18H24N4O3S — CID 51936190
(3R,7aR)-7a-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 51936190) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is (3R,7aR)-7a-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aR)-7a-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 51936190 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (3R,7aR)-7a-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@@]12CCC(=O)N1[C@H](C(=O)NCc1ccnc(N3CCOCC3)c1)CS2 |
| InChI | InChI=1S/C18H24N4O3S/c1-18-4-2-16(23)22(18)14(12-26-18)17(24)20-11-13-3-5-19-15(10-13)21-6-8-25-9-7-21/h3,5,10,14H,2,4,6-9,11-12H2,1H3,(H,20,24)/t14-,18+/m0/s1 |
| InChIKey | GAJVZPOTPRPCMR-KBXCAEBGSA-N |
| XLogP | 0.99 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |