C21H22ClN3O2S — CID 51938682
N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(cyanomethylsulfanyl)benzamide (PubChem CID 51938682) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(cyanomethylsulfanyl)benzamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(cyanomethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 51938682 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(cyanomethylsulfanyl)benzamide |
| SMILES | N#CCSc1ccccc1C(=O)NC[C@@H](c1ccccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C21H22ClN3O2S/c22-18-7-3-1-5-16(18)19(25-10-12-27-13-11-25)15-24-21(26)17-6-2-4-8-20(17)28-14-9-23/h1-8,19H,10-15H2,(H,24,26)/t19-/m0/s1 |
| InChIKey | RROQQXLZEVBSOV-IBGZPJMESA-N |
| XLogP | 3.76 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |