C21H27N3O4S — CID 51944299
1-[(1R)-1-(4-ethylphenyl)ethyl]-3-(3-morpholin-4-ylsulfonylphenyl)urea (PubChem CID 51944299) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-[(1R)-1-(4-ethylphenyl)ethyl]-3-(3-morpholin-4-ylsulfonylphenyl)urea.
| Compound Name | 1-[(1R)-1-(4-ethylphenyl)ethyl]-3-(3-morpholin-4-ylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 51944299 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[(1R)-1-(4-ethylphenyl)ethyl]-3-(3-morpholin-4-ylsulfonylphenyl)urea |
| SMILES | CCc1ccc([C@@H](C)NC(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C21H27N3O4S/c1-3-17-7-9-18(10-8-17)16(2)22-21(25)23-19-5-4-6-20(15-19)29(26,27)24-11-13-28-14-12-24/h4-10,15-16H,3,11-14H2,1-2H3,(H2,22,23,25)/t16-/m1/s1 |
| InChIKey | PMOUHAHTQQUTJQ-MRXNPFEDSA-N |
| XLogP | 3.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |