C21H27FN4O3S — CID 146129121
1-[1-(4-fluoro-3-methylphenyl)ethyl]-3-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]urea (PubChem CID 146129121) has the molecular formula C21H27FN4O3S and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[1-(4-fluoro-3-methylphenyl)ethyl]-3-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]urea.
| Compound Name | 1-[1-(4-fluoro-3-methylphenyl)ethyl]-3-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 146129121 |
| Molecular Formula | C21H27FN4O3S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[1-(4-fluoro-3-methylphenyl)ethyl]-3-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]urea |
| SMILES | Cc1cc(C(C)NC(=O)Nc2cccc(S(=O)(=O)N3CCN(C)CC3)c2)ccc1F |
| InChI | InChI=1S/C21H27FN4O3S/c1-15-13-17(7-8-20(15)22)16(2)23-21(27)24-18-5-4-6-19(14-18)30(28,29)26-11-9-25(3)10-12-26/h4-8,13-14,16H,9-12H2,1-3H3,(H2,23,24,27) |
| InChIKey | UDVXKNODTDEMJL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |