C22H29ClN4O3S — CID 146123845
1-[1-(3-chlorophenyl)propyl]-3-[3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]urea (PubChem CID 146123845) has the molecular formula C22H29ClN4O3S and a molecular weight of 465.02 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)propyl]-3-[3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]urea.
| Compound Name | 1-[1-(3-chlorophenyl)propyl]-3-[3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]urea |
|---|---|
| PubChem CID | 146123845 |
| Molecular Formula | C22H29ClN4O3S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[1-(3-chlorophenyl)propyl]-3-[3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]urea |
| SMILES | CCC(NC(=O)Nc1cccc(S(=O)(=O)N2CCCN(C)CC2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H29ClN4O3S/c1-3-21(17-7-4-8-18(23)15-17)25-22(28)24-19-9-5-10-20(16-19)31(29,30)27-12-6-11-26(2)13-14-27/h4-5,7-10,15-16,21H,3,6,11-14H2,1-2H3,(H2,24,25,28) |
| InChIKey | APQGVCBLDAFGKH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |