C14H13Br2N3O — CID 51944656
1-(2,4-dibromophenyl)-3-[(1S)-1-pyridin-2-ylethyl]urea (PubChem CID 51944656) has the molecular formula C14H13Br2N3O and a molecular weight of 399.09 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-3-[(1S)-1-pyridin-2-ylethyl]urea.
| Compound Name | 1-(2,4-dibromophenyl)-3-[(1S)-1-pyridin-2-ylethyl]urea |
|---|---|
| PubChem CID | 51944656 |
| Molecular Formula | C14H13Br2N3O |
| Molecular Weight | 399.09 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | 1-(2,4-dibromophenyl)-3-[(1S)-1-pyridin-2-ylethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(Br)cc1Br)c1ccccn1 |
| InChI | InChI=1S/C14H13Br2N3O/c1-9(12-4-2-3-7-17-12)18-14(20)19-13-6-5-10(15)8-11(13)16/h2-9H,1H3,(H2,18,19,20)/t9-/m0/s1 |
| InChIKey | ZAXCPECSYXAYBW-VIFPVBQESA-N |
| XLogP | 4.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.09 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |