C16H20N2O4S2 — CID 51947181
N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(methoxysulfamoyl)benzamide (PubChem CID 51947181) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(methoxysulfamoyl)benzamide.
| Compound Name | N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(methoxysulfamoyl)benzamide |
|---|---|
| PubChem CID | 51947181 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(methoxysulfamoyl)benzamide |
| SMILES | CONS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2cc(C)sc2C)cc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-10-9-15(12(3)23-10)11(2)17-16(19)13-5-7-14(8-6-13)24(20,21)18-22-4/h5-9,11,18H,1-4H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | LYUDQGJBGLOUGN-LLVKDONJSA-N |
| XLogP | 2.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|