C18H26BrN3O3 — CID 51947951
4-bromo-N-[(2S)-1-[[4-(diethylamino)-4-oxobutyl]amino]-1-oxopropan-2-yl]benzamide (PubChem CID 51947951) has the molecular formula C18H26BrN3O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is 4-bromo-N-[(2S)-1-[[4-(diethylamino)-4-oxobutyl]amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-bromo-N-[(2S)-1-[[4-(diethylamino)-4-oxobutyl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 51947951 |
| Molecular Formula | C18H26BrN3O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-bromo-N-[(2S)-1-[[4-(diethylamino)-4-oxobutyl]amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CCN(CC)C(=O)CCCNC(=O)[C@H](C)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H26BrN3O3/c1-4-22(5-2)16(23)7-6-12-20-17(24)13(3)21-18(25)14-8-10-15(19)11-9-14/h8-11,13H,4-7,12H2,1-3H3,(H,20,24)(H,21,25)/t13-/m0/s1 |
| InChIKey | GOWABORABYYIGM-ZDUSSCGKSA-N |
| XLogP | 2.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|