C20H23NO3S — CID 51948049
[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methanone (PubChem CID 51948049) has the molecular formula C20H23NO3S and a molecular weight of 357.47 g/mol. Its IUPAC name is [3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methanone.
| Compound Name | [3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 51948049 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccc(OC[C@@H]2CCCO2)c1)N1CCC[C@H]1c1ccsc1 |
| InChI | InChI=1S/C20H23NO3S/c22-20(21-9-2-7-19(21)16-8-11-25-14-16)15-4-1-5-17(12-15)24-13-18-6-3-10-23-18/h1,4-5,8,11-12,14,18-19H,2-3,6-7,9-10,13H2/t18-,19-/m0/s1 |
| InChIKey | PBTRRCLRPDRBNR-OALUTQOASA-N |
| XLogP | 4.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |