C21H26N2O3S — CID 51949196
tert-butyl N-[4-[2-oxo-2-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethyl]phenyl]carbamate (PubChem CID 51949196) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is tert-butyl N-[4-[2-oxo-2-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-oxo-2-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 51949196 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | tert-butyl N-[4-[2-oxo-2-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CC(=O)N2CCC[C@H]2c2ccsc2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-21(2,3)26-20(25)22-17-8-6-15(7-9-17)13-19(24)23-11-4-5-18(23)16-10-12-27-14-16/h6-10,12,14,18H,4-5,11,13H2,1-3H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | GXWONEUKCBXRCO-SFHVURJKSA-N |
| XLogP | 5.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |