C14H14N2O2S — CID 51949489
(1R)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 51949489) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is (1R)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 51949489 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (1R)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccco2)cs1)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C14H14N2O2S/c17-13(10-5-2-1-3-6-10)16-14-15-11(9-19-14)12-7-4-8-18-12/h1-2,4,7-10H,3,5-6H2,(H,15,16,17)/t10-/m0/s1 |
| InChIKey | XXEOJRGVQXEWKW-JTQLQIEISA-N |
| XLogP | 3.70 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|