C9H11N3OS — CID 29369503
(1S)-N-(1,3,4-thiadiazol-2-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 29369503) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is (1S)-N-(1,3,4-thiadiazol-2-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-(1,3,4-thiadiazol-2-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 29369503 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (1S)-N-(1,3,4-thiadiazol-2-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1nncs1)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C9H11N3OS/c13-8(7-4-2-1-3-5-7)11-9-12-10-6-14-9/h1-2,6-7H,3-5H2,(H,11,12,13)/t7-/m1/s1 |
| InChIKey | MCHGEELEKIXILJ-SSDOTTSWSA-N |
| XLogP | 1.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|