C18H22N2O7S — CID 51954017
(3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 51954017) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is (3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51954017 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc2c(c1)OCO2)[C@H]1CC(=O)N([C@H]2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C18H22N2O7S/c21-17-7-12(9-20(17)13-3-6-28(23,24)10-13)18(22)19-4-5-25-14-1-2-15-16(8-14)27-11-26-15/h1-2,8,12-13H,3-7,9-11H2,(H,19,22)/t12-,13-/m0/s1 |
| InChIKey | NMPXZNDNVDOOEX-STQMWFEESA-N |
| XLogP | -0.05 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|