C15H26N2O5S — CID 94177997
(3S)-1-[(3R)-1,1-dioxothiolan-3-yl]-5-oxo-N-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxamide (PubChem CID 94177997) has the molecular formula C15H26N2O5S and a molecular weight of 346.45 g/mol. Its IUPAC name is (3S)-1-[(3R)-1,1-dioxothiolan-3-yl]-5-oxo-N-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[(3R)-1,1-dioxothiolan-3-yl]-5-oxo-N-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94177997 |
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (3S)-1-[(3R)-1,1-dioxothiolan-3-yl]-5-oxo-N-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)OCCCNC(=O)[C@H]1CC(=O)N([C@@H]2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C15H26N2O5S/c1-11(2)22-6-3-5-16-15(19)12-8-14(18)17(9-12)13-4-7-23(20,21)10-13/h11-13H,3-10H2,1-2H3,(H,16,19)/t12-,13+/m0/s1 |
| InChIKey | UYCLRTWPEXUKRV-QWHCGFSZSA-N |
| XLogP | -0.05 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|