C21H24FNO3 — CID 51955546
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-[(2-fluorophenoxy)methyl]furan-2-yl]methanone (PubChem CID 51955546) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-[(2-fluorophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-[(2-fluorophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 51955546 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-[(2-fluorophenoxy)methyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2ccccc2F)o1)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H24FNO3/c22-17-8-2-4-10-19(17)25-14-16-11-12-20(26-16)21(24)23-13-5-7-15-6-1-3-9-18(15)23/h2,4,8,10-12,15,18H,1,3,5-7,9,13-14H2/t15-,18+/m0/s1 |
| InChIKey | YRQXCKIPKKXNRH-MAUKXSAKSA-N |
| XLogP | 4.79 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |