C21H22N4O3S — CID 51956796
2-(1H-indol-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide (PubChem CID 51956796) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 51956796 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1ccc(NC(=O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-25-12-4-7-20(25)24-29(27,28)17-10-8-16(9-11-17)23-21(26)13-15-14-22-19-6-3-2-5-18(15)19/h2-3,5-6,8-11,14,22H,4,7,12-13H2,1H3,(H,23,26) |
| InChIKey | BKEDKKMLCLWSKC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|