C18H20FNOS — CID 51958369
(2S)-2-benzylsulfanyl-N-[(1R)-1-(3-fluorophenyl)ethyl]propanamide (PubChem CID 51958369) has the molecular formula C18H20FNOS and a molecular weight of 317.43 g/mol. Its IUPAC name is (2S)-2-benzylsulfanyl-N-[(1R)-1-(3-fluorophenyl)ethyl]propanamide.
| Compound Name | (2S)-2-benzylsulfanyl-N-[(1R)-1-(3-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 51958369 |
| Molecular Formula | C18H20FNOS |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (2S)-2-benzylsulfanyl-N-[(1R)-1-(3-fluorophenyl)ethyl]propanamide |
| SMILES | C[C@H](SCc1ccccc1)C(=O)N[C@H](C)c1cccc(F)c1 |
| InChI | InChI=1S/C18H20FNOS/c1-13(16-9-6-10-17(19)11-16)20-18(21)14(2)22-12-15-7-4-3-5-8-15/h3-11,13-14H,12H2,1-2H3,(H,20,21)/t13-,14+/m1/s1 |
| InChIKey | PUGIXYHJZMCQSO-KGLIPLIRSA-N |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |