C21H27NOS — CID 94020092
(2S)-2-benzylsulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]propanamide (PubChem CID 94020092) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is (2S)-2-benzylsulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]propanamide.
| Compound Name | (2S)-2-benzylsulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 94020092 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2S)-2-benzylsulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]propanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)SCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NOS/c1-16(2)14-20(19-12-8-5-9-13-19)22-21(23)17(3)24-15-18-10-6-4-7-11-18/h4-13,16-17,20H,14-15H2,1-3H3,(H,22,23)/t17-,20-/m0/s1 |
| InChIKey | XXTJRGRFOXQXJB-PXNSSMCTSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |