C20H22N2O3S — CID 5195902
3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)-1-(1-thiophen-2-ylethyl)urea (PubChem CID 5195902) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)-1-(1-thiophen-2-ylethyl)urea.
| Compound Name | 3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)-1-(1-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 5195902 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)-1-(1-thiophen-2-ylethyl)urea |
| SMILES | CCOc1ccc(NC(=O)N(Cc2ccco2)C(C)c2cccs2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-24-17-10-8-16(9-11-17)21-20(23)22(14-18-6-4-12-25-18)15(2)19-7-5-13-26-19/h4-13,15H,3,14H2,1-2H3,(H,21,23) |
| InChIKey | UOYWADSBHCWQCR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |