C27H26N2O2 — CID 42709329
1-benzhydryl-3-(4-ethylphenyl)-1-(furan-2-ylmethyl)urea (PubChem CID 42709329) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-benzhydryl-3-(4-ethylphenyl)-1-(furan-2-ylmethyl)urea.
| Compound Name | 1-benzhydryl-3-(4-ethylphenyl)-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 42709329 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-benzhydryl-3-(4-ethylphenyl)-1-(furan-2-ylmethyl)urea |
| SMILES | CCc1ccc(NC(=O)N(Cc2ccco2)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O2/c1-2-21-15-17-24(18-16-21)28-27(30)29(20-25-14-9-19-31-25)26(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-19,26H,2,20H2,1H3,(H,28,30) |
| InChIKey | ODLYGJIBEYDWMJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |