C17H20N2O4 — CID 122019561
4-[[[furan-2-ylmethyl(propan-2-yl)carbamoyl]amino]methyl]benzoic acid (PubChem CID 122019561) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[[[furan-2-ylmethyl(propan-2-yl)carbamoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[furan-2-ylmethyl(propan-2-yl)carbamoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122019561 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-[[[furan-2-ylmethyl(propan-2-yl)carbamoyl]amino]methyl]benzoic acid |
| SMILES | CC(C)N(Cc1ccco1)C(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-12(2)19(11-15-4-3-9-23-15)17(22)18-10-13-5-7-14(8-6-13)16(20)21/h3-9,12H,10-11H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | YMLFWERLZKHNSI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |