C16H19N5O3 — CID 125155612
3-(2H-benzotriazol-5-yl)-1-(furan-2-ylmethyl)-1-[(2S)-1-hydroxybutan-2-yl]urea (PubChem CID 125155612) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-(2H-benzotriazol-5-yl)-1-(furan-2-ylmethyl)-1-[(2S)-1-hydroxybutan-2-yl]urea.
| Compound Name | 3-(2H-benzotriazol-5-yl)-1-(furan-2-ylmethyl)-1-[(2S)-1-hydroxybutan-2-yl]urea |
|---|---|
| PubChem CID | 125155612 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-(2H-benzotriazol-5-yl)-1-(furan-2-ylmethyl)-1-[(2S)-1-hydroxybutan-2-yl]urea |
| SMILES | CC[C@@H](CO)N(Cc1ccco1)C(=O)Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C16H19N5O3/c1-2-12(10-22)21(9-13-4-3-7-24-13)16(23)17-11-5-6-14-15(8-11)19-20-18-14/h3-8,12,22H,2,9-10H2,1H3,(H,17,23)(H,18,19,20)/t12-/m0/s1 |
| InChIKey | JEJDXROSBVARRO-LBPRGKRZSA-N |
| XLogP | 2.36 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |