C16H18N2O5S — CID 51964989
methyl 4-[2-[(5S)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]ethoxy]benzoate (PubChem CID 51964989) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is methyl 4-[2-[(5S)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[(5S)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 51964989 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | methyl 4-[2-[(5S)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCN2C(=O)N[C@@]3(CCSC3)C2=O)cc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-22-13(19)11-2-4-12(5-3-11)23-8-7-18-14(20)16(17-15(18)21)6-9-24-10-16/h2-5H,6-10H2,1H3,(H,17,21)/t16-/m1/s1 |
| InChIKey | DVOXVVXVAIQCHI-MRXNPFEDSA-N |
| XLogP | 1.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|