C17H28N2O4S2 — CID 51966450
4-ethylsulfonyl-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]benzenesulfonamide (PubChem CID 51966450) has the molecular formula C17H28N2O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]benzenesulfonamide.
| Compound Name | 4-ethylsulfonyl-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51966450 |
| Molecular Formula | C17H28N2O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-ethylsulfonyl-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]benzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(S(=O)(=O)NC[C@H](C)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C17H28N2O4S2/c1-3-24(20,21)16-7-9-17(10-8-16)25(22,23)18-13-15(2)14-19-11-5-4-6-12-19/h7-10,15,18H,3-6,11-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | CLADXVMODPMMKM-HNNXBMFYSA-N |
| XLogP | 1.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |