C15H24FN3O2S — CID 60530804
4-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide (PubChem CID 60530804) has the molecular formula C15H24FN3O2S and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60530804 |
| Molecular Formula | C15H24FN3O2S |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1ccc(F)cc1)CN1CCN(C)CC1 |
| InChI | InChI=1S/C15H24FN3O2S/c1-13(12-19-9-7-18(2)8-10-19)11-17-22(20,21)15-5-3-14(16)4-6-15/h3-6,13,17H,7-12H2,1-2H3 |
| InChIKey | GYBGXSOBASPSEA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |