C20H33N3O3S — CID 87024812
4-cyclopentyloxy-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide (PubChem CID 87024812) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-cyclopentyloxy-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87024812 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 4-cyclopentyloxy-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1ccc(OC2CCCC2)cc1)CN1CCN(C)CC1 |
| InChI | InChI=1S/C20H33N3O3S/c1-17(16-23-13-11-22(2)12-14-23)15-21-27(24,25)20-9-7-19(8-10-20)26-18-5-3-4-6-18/h7-10,17-18,21H,3-6,11-16H2,1-2H3 |
| InChIKey | KCYTYNWPSSJGRC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |