C21H28N2O2 — CID 51966524
(3R)-N-cyclopentyl-1-(2,3-dimethylphenyl)-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 51966524) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (3R)-N-cyclopentyl-1-(2,3-dimethylphenyl)-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopentyl-1-(2,3-dimethylphenyl)-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51966524 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3R)-N-cyclopentyl-1-(2,3-dimethylphenyl)-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1CC(=O)N(c2cccc(C)c2C)C1)C1CCCC1 |
| InChI | InChI=1S/C21H28N2O2/c1-4-12-22(18-9-5-6-10-18)21(25)17-13-20(24)23(14-17)19-11-7-8-15(2)16(19)3/h4,7-8,11,17-18H,1,5-6,9-10,12-14H2,2-3H3/t17-/m1/s1 |
| InChIKey | LJTMKFHTQLCAPL-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|